C16H15N7 — CID 59341881
N-ethyl-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine (PubChem CID 59341881) has the molecular formula C16H15N7 and a molecular weight of 305.35 g/mol. Its IUPAC name is N-ethyl-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine.
| Compound Name | N-ethyl-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 59341881 |
| Molecular Formula | C16H15N7 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-ethyl-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine |
| SMILES | CCNc1cnc2nnn(Cc3ccc4ncccc4c3)c2n1 |
| InChI | InChI=1S/C16H15N7/c1-2-17-14-9-19-15-16(20-14)23(22-21-15)10-11-5-6-13-12(8-11)4-3-7-18-13/h3-9H,2,10H2,1H3,(H,17,20) |
| InChIKey | ZCPQOAVPCMNWRI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |