C24H10F4N2O2 — CID 59342325
9,14,15,16-tetrafluoro-23,26-diazapentacyclo[17.3.1.12,6.17,11.113,17]hexacosa-1(23),2(26),3,5,7(25),8,10,13,15,17(24),19,21-dodecaene-12,18-dione (PubChem CID 59342325) has the molecular formula C24H10F4N2O2 and a molecular weight of 434.35 g/mol. Its IUPAC name is 9,14,15,16-tetrafluoro-23,26-diazapentacyclo[17.3.1.12,6.17,11.113,17]hexacosa-1(23),2(26),3,5,7(25),8,10,13,15,17(24),19,21-dodecaene-12,18-dione.
| Compound Name | 9,14,15,16-tetrafluoro-23,26-diazapentacyclo[17.3.1.12,6.17,11.113,17]hexacosa-1(23),2(26),3,5,7(25),8,10,13,15,17(24),19,21-dodecaene-12,18-dione |
|---|---|
| PubChem CID | 59342325 |
| Molecular Formula | C24H10F4N2O2 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 9,14,15,16-tetrafluoro-23,26-diazapentacyclo[17.3.1.12,6.17,11.113,17]hexacosa-1(23),2(26),3,5,7(25),8,10,13,15,17(24),19,21-dodecaene-12,18-dione |
| SMILES | O=C1c2cc(F)cc(c2)-c2cccc(n2)-c2cccc(n2)C(=O)c2cc1c(F)c(F)c2F |
| InChI | InChI=1S/C24H10F4N2O2/c25-13-8-11-7-12(9-13)23(31)14-10-15(21(27)22(28)20(14)26)24(32)19-6-2-5-18(30-19)17-4-1-3-16(11)29-17/h1-10H |
| InChIKey | NHLNVJJETPLZSP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|