C38H34F2O5S — CID 59342724
[2,6-difluoro-4-[4-(4-hydroxy-9,10-dioxoanthracen-1-yl)sulfanylphenyl]phenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 59342724) has the molecular formula C38H34F2O5S and a molecular weight of 640.75 g/mol. Its IUPAC name is [2,6-difluoro-4-[4-(4-hydroxy-9,10-dioxoanthracen-1-yl)sulfanylphenyl]phenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [2,6-difluoro-4-[4-(4-hydroxy-9,10-dioxoanthracen-1-yl)sulfanylphenyl]phenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59342724 |
| Molecular Formula | C38H34F2O5S |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | [2,6-difluoro-4-[4-(4-hydroxy-9,10-dioxoanthracen-1-yl)sulfanylphenyl]phenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2c(F)cc(-c3ccc(Sc4ccc(O)c5c4C(=O)c4ccccc4C5=O)cc3)cc2F)CC1 |
| InChI | InChI=1S/C38H34F2O5S/c1-2-3-4-7-22-10-12-24(13-11-22)38(44)45-37-29(39)20-25(21-30(37)40)23-14-16-26(17-15-23)46-32-19-18-31(41)33-34(32)36(43)28-9-6-5-8-27(28)35(33)42/h5-6,8-9,14-22,24,41H,2-4,7,10-13H2,1H3 |
| InChIKey | VMALWKCKVPNMDQ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|