C51H54F2O4S — CID 59342755
2-(3,5-difluoro-4-pentylphenyl)-4-[4-[3,5-dimethyl-4-[(4-pentylcyclohexyl)methoxy]phenyl]phenyl]sulfanyl-1-hydroxyanthracene-9,10-dione (PubChem CID 59342755) has the molecular formula C51H54F2O4S and a molecular weight of 801.05 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-pentylphenyl)-4-[4-[3,5-dimethyl-4-[(4-pentylcyclohexyl)methoxy]phenyl]phenyl]sulfanyl-1-hydroxyanthracene-9,10-dione.
| Compound Name | 2-(3,5-difluoro-4-pentylphenyl)-4-[4-[3,5-dimethyl-4-[(4-pentylcyclohexyl)methoxy]phenyl]phenyl]sulfanyl-1-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 59342755 |
| Molecular Formula | C51H54F2O4S |
| Molecular Weight | 801.05 g/mol |
| Exact Mass | 800.37 |
| IUPAC Name | 2-(3,5-difluoro-4-pentylphenyl)-4-[4-[3,5-dimethyl-4-[(4-pentylcyclohexyl)methoxy]phenyl]phenyl]sulfanyl-1-hydroxyanthracene-9,10-dione |
| SMILES | CCCCCc1c(F)cc(-c2cc(Sc3ccc(-c4cc(C)c(OCC5CCC(CCCCC)CC5)c(C)c4)cc3)c3c(c2O)C(=O)c2ccccc2C3=O)cc1F |
| InChI | InChI=1S/C51H54F2O4S/c1-5-7-9-13-33-17-19-34(20-18-33)30-57-51-31(3)25-36(26-32(51)4)35-21-23-38(24-22-35)58-45-29-42(37-27-43(52)41(44(53)28-37)16-10-8-6-2)50(56)47-46(45)48(54)39-14-11-12-15-40(39)49(47)55/h11-12,14-15,21-29,33-34,56H,5-10,13,16-20,30H2,1-4H3 |
| InChIKey | FPIXXNHSWMTEKL-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.05 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|