About 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate
4-O-(4-acetamidobutyl) 1-O-methyl butanedioate (PubChem CID 59342787) has the molecular formula C11H19NO5
and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate |
| PubChem CID | 59342787 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCCCCNC(C)=O |
| InChI | InChI=1S/C11H19NO5/c1-9(13)12-7-3-4-8-17-11(15)6-5-10(14)16-2/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | XTFURVVAIOCTCX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate?
The IUPAC name of 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate (CID 59342787) is 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate?
The canonical SMILES for 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate is COC(=O)CCC(=O)OCCCCNC(C)=O.
What is the InChIKey of 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate?
The InChIKey is XTFURVVAIOCTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO5/c1-9(13)12-7-3-4-8-17-11(15)6-5-10(14)16-2/h3-8H2,1-2H3,(H,12,13).
What are the key properties of 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate?
4-O-(4-acetamidobutyl) 1-O-methyl butanedioate has a molecular weight of 245.27 g/mol, XLogP of 0.40, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(4-acetamidobutyl) 1-O-methyl butanedioate is sourced from PubChem (CID 59342787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).