C22H46O2 — CID 59343027
3,5,5-trimethyl-1-[4-(3,5,5-trimethylhexoxy)butoxy]hexane (PubChem CID 59343027) has the molecular formula C22H46O2 and a molecular weight of 342.61 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-[4-(3,5,5-trimethylhexoxy)butoxy]hexane.
| Compound Name | 3,5,5-trimethyl-1-[4-(3,5,5-trimethylhexoxy)butoxy]hexane |
|---|---|
| PubChem CID | 59343027 |
| Molecular Formula | C22H46O2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.35 |
| IUPAC Name | 3,5,5-trimethyl-1-[4-(3,5,5-trimethylhexoxy)butoxy]hexane |
| SMILES | CC(CCOCCCCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C22H46O2/c1-19(17-21(3,4)5)11-15-23-13-9-10-14-24-16-12-20(2)18-22(6,7)8/h19-20H,9-18H2,1-8H3 |
| InChIKey | ANLZAWZQNDFTGN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|