C17H24N2O5S — CID 59343157
1-benzyl-3-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]thiourea (PubChem CID 59343157) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-benzyl-3-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]thiourea.
| Compound Name | 1-benzyl-3-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]thiourea |
|---|---|
| PubChem CID | 59343157 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-benzyl-3-[(10,11-dihydroxy-2,6,8-trioxabicyclo[5.2.2]undecan-9-yl)methyl]thiourea |
| SMILES | OC1C2OCCCOC(C(CNC(=S)NCc3ccccc3)O2)C1O |
| InChI | InChI=1S/C17H24N2O5S/c20-13-14(21)16-23-8-4-7-22-15(13)12(24-16)10-19-17(25)18-9-11-5-2-1-3-6-11/h1-3,5-6,12-16,20-21H,4,7-10H2,(H2,18,19,25) |
| InChIKey | UCCNAHJFBYSCDT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|