C12H22ClNO5S — CID 59343183
9-[3-(chloroamino)propylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol (PubChem CID 59343183) has the molecular formula C12H22ClNO5S and a molecular weight of 327.83 g/mol. Its IUPAC name is 9-[3-(chloroamino)propylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol.
| Compound Name | 9-[3-(chloroamino)propylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
|---|---|
| PubChem CID | 59343183 |
| Molecular Formula | C12H22ClNO5S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 9-[3-(chloroamino)propylsulfanylmethyl]-2,6,8-trioxabicyclo[5.2.2]undecane-10,11-diol |
| SMILES | OC1C2OCCCOC(C(CSCCCNCl)O2)C1O |
| InChI | InChI=1S/C12H22ClNO5S/c13-14-3-1-6-20-7-8-11-9(15)10(16)12(19-8)18-5-2-4-17-11/h8-12,14-16H,1-7H2 |
| InChIKey | LWXUOUMBLCEMDD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|