About iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol
iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol (PubChem CID 59343979) has the molecular formula C22H15IrN2OS-
and a molecular weight of 547.66 g/mol. Its IUPAC name is iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol.
Molecular Properties
| Compound Name | iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol |
| PubChem CID | 59343979 |
| Molecular Formula | C22H15IrN2OS- |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol |
| SMILES | Oc1cccc2cccnc12.[Ir].[c-]1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H8NS.C9H7NO.Ir/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,8-9H;1-6,11H;/q-1;; |
| InChIKey | LQZRGGHKIWFIGX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol?
The IUPAC name of iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol (CID 59343979) is iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol.
What is the SMILES notation for iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol?
The canonical SMILES for iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol is Oc1cccc2cccnc12.[Ir].[c-]1ccccc1-c1nc2ccccc2s1.
What is the InChIKey of iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol?
The InChIKey is LQZRGGHKIWFIGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8NS.C9H7NO.Ir/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,8-9H;1-6,11H;/q-1;;.
What are the key properties of iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol?
iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol has a molecular weight of 547.66 g/mol, XLogP of 5.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-phenyl-1,3-benzothiazole;quinolin-8-ol is sourced from PubChem (CID 59343979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).