C37H22F6N4 — CID 59344112
9-[4-[1,1,1,3,3,3-hexafluoro-2-(4-pyrido[3,4-b]indol-9-ylphenyl)propan-2-yl]phenyl]pyrido[3,4-b]indole (PubChem CID 59344112) has the molecular formula C37H22F6N4 and a molecular weight of 636.60 g/mol. Its IUPAC name is 9-[4-[1,1,1,3,3,3-hexafluoro-2-(4-pyrido[3,4-b]indol-9-ylphenyl)propan-2-yl]phenyl]pyrido[3,4-b]indole.
| Compound Name | 9-[4-[1,1,1,3,3,3-hexafluoro-2-(4-pyrido[3,4-b]indol-9-ylphenyl)propan-2-yl]phenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 59344112 |
| Molecular Formula | C37H22F6N4 |
| Molecular Weight | 636.60 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | 9-[4-[1,1,1,3,3,3-hexafluoro-2-(4-pyrido[3,4-b]indol-9-ylphenyl)propan-2-yl]phenyl]pyrido[3,4-b]indole |
| SMILES | FC(F)(F)C(c1ccc(-n2c3ccccc3c3ccncc32)cc1)(c1ccc(-n2c3ccccc3c3ccncc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C37H22F6N4/c38-36(39,40)35(37(41,42)43,23-9-13-25(14-10-23)46-31-7-3-1-5-27(31)29-17-19-44-21-33(29)46)24-11-15-26(16-12-24)47-32-8-4-2-6-28(32)30-18-20-45-22-34(30)47/h1-22H |
| InChIKey | PEUJERRHEZOHMX-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.60 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |