C56H50N4 — CID 59344138
5-[4-[2,6-dimethyl-4-[8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indol-5-yl]phenyl]-3,5-dimethylphenyl]-8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indole (PubChem CID 59344138) has the molecular formula C56H50N4 and a molecular weight of 779.04 g/mol. Its IUPAC name is 5-[4-[2,6-dimethyl-4-[8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indol-5-yl]phenyl]-3,5-dimethylphenyl]-8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indole.
| Compound Name | 5-[4-[2,6-dimethyl-4-[8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indol-5-yl]phenyl]-3,5-dimethylphenyl]-8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 59344138 |
| Molecular Formula | C56H50N4 |
| Molecular Weight | 779.04 g/mol |
| Exact Mass | 778.40 |
| IUPAC Name | 5-[4-[2,6-dimethyl-4-[8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indol-5-yl]phenyl]-3,5-dimethylphenyl]-8-(2,4,6-trimethylphenyl)pyrido[4,3-b]indole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2cnccc2n3-c2cc(C)c(-c3c(C)cc(-n4c5ccncc5c5cc(-c6c(C)cc(C)cc6C)ccc54)cc3C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C56H50N4/c1-31-19-33(3)53(34(4)20-31)41-11-13-49-45(27-41)47-29-57-17-15-51(47)59(49)43-23-37(7)55(38(8)24-43)56-39(9)25-44(26-40(56)10)60-50-14-12-42(54-35(5)21-32(2)22-36(54)6)28-46(50)48-30-58-18-16-52(48)60/h11-30H,1-10H3 |
| InChIKey | NKTKWRWLHUOKHF-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.04 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |