C29H29N3 — CID 59344164
8-methyl-4,12-bis(2,4,6-trimethylphenyl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59344164) has the molecular formula C29H29N3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 8-methyl-4,12-bis(2,4,6-trimethylphenyl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-methyl-4,12-bis(2,4,6-trimethylphenyl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59344164 |
| Molecular Formula | C29H29N3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 8-methyl-4,12-bis(2,4,6-trimethylphenyl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1cc(C)c(-c2cnc3c(c2)c2cc(-c4c(C)cc(C)cc4C)cnc2n3C)c(C)c1 |
| InChI | InChI=1S/C29H29N3/c1-16-8-18(3)26(19(4)9-16)22-12-24-25-13-23(27-20(5)10-17(2)11-21(27)6)15-31-29(25)32(7)28(24)30-14-22/h8-15H,1-7H3 |
| InChIKey | JCVFHWYZQGNTPW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |