About (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate
(4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate (PubChem CID 59344314) has the molecular formula C14H20O6S
and a molecular weight of 316.38 g/mol. Its IUPAC name is (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate.
Molecular Properties
| Compound Name | (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate |
| PubChem CID | 59344314 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate |
| SMILES | CC(C)(SOOO)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C14H20O6S/c1-13(2,21-20-19-17)12(16)18-14-5-8-3-9(6-14)11(15)10(4-8)7-14/h8-10,17H,3-7H2,1-2H3 |
| InChIKey | UIRJSXSAAUKTQF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
The IUPAC name of (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate (CID 59344314) is (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate.
What is the SMILES notation for (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
The canonical SMILES for (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate is CC(C)(SOOO)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2.
What is the InChIKey of (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
The InChIKey is UIRJSXSAAUKTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O6S/c1-13(2,21-20-19-17)12(16)18-14-5-8-3-9(6-14)11(15)10(4-8)7-14/h8-10,17H,3-7H2,1-2H3.
What are the key properties of (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate?
(4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate has a molecular weight of 316.38 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1-adamantyl) 2-methyl-2-(trioxidanylsulfanyl)propanoate is sourced from PubChem (CID 59344314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).