About 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate
1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 59344473) has the molecular formula C13H16O6
and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate.
Molecular Properties
| Compound Name | 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate |
| PubChem CID | 59344473 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OC(C)C1C2CC3C(=O)OC1C3O2 |
| InChI | InChI=1S/C13H16O6/c1-5(4-14)12(15)17-6(2)9-8-3-7-10(18-8)11(9)19-13(7)16/h6-11,14H,1,3-4H2,2H3 |
| InChIKey | UIEQAPDGYLBHIJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate?
The IUPAC name of 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate (CID 59344473) is 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate.
What is the SMILES notation for 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate?
The canonical SMILES for 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate is C=C(CO)C(=O)OC(C)C1C2CC3C(=O)OC1C3O2.
What is the InChIKey of 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate?
The InChIKey is UIEQAPDGYLBHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O6/c1-5(4-14)12(15)17-6(2)9-8-3-7-10(18-8)11(9)19-13(7)16/h6-11,14H,1,3-4H2,2H3.
What are the key properties of 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate?
1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate has a molecular weight of 268.26 g/mol, XLogP of -0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)ethyl 2-(hydroxymethyl)prop-2-enoate is sourced from PubChem (CID 59344473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).