About 4-oxidooxyiminocyclohexa-2,5-dien-1-one
4-oxidooxyiminocyclohexa-2,5-dien-1-one (PubChem CID 59344489) has the molecular formula C6H4NO3-
and a molecular weight of 138.10 g/mol. Its IUPAC name is 4-oxidooxyiminocyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-oxidooxyiminocyclohexa-2,5-dien-1-one |
| PubChem CID | 59344489 |
| Molecular Formula | C6H4NO3- |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 4-oxidooxyiminocyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=NO[O-])C=C1 |
| InChI | InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7-10-9/h1-4,9H/p-1 |
| InChIKey | YCRISVYDPAWOAJ-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-oxidooxyiminocyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxidooxyiminocyclohexa-2,5-dien-1-one?
The IUPAC name of 4-oxidooxyiminocyclohexa-2,5-dien-1-one (CID 59344489) is 4-oxidooxyiminocyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-oxidooxyiminocyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-oxidooxyiminocyclohexa-2,5-dien-1-one is O=C1C=CC(=NO[O-])C=C1.
What is the InChIKey of 4-oxidooxyiminocyclohexa-2,5-dien-1-one?
The InChIKey is YCRISVYDPAWOAJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7-10-9/h1-4,9H/p-1.
What are the key properties of 4-oxidooxyiminocyclohexa-2,5-dien-1-one?
4-oxidooxyiminocyclohexa-2,5-dien-1-one has a molecular weight of 138.10 g/mol, XLogP of -0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxidooxyiminocyclohexa-2,5-dien-1-one is sourced from PubChem (CID 59344489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).