About 3,5-dinitro-1,3,5-triazinan-1-amine
3,5-dinitro-1,3,5-triazinan-1-amine (PubChem CID 59344524) has the molecular formula C3H8N6O4
and a molecular weight of 192.13 g/mol. Its IUPAC name is 3,5-dinitro-1,3,5-triazinan-1-amine.
Molecular Properties
| Compound Name | 3,5-dinitro-1,3,5-triazinan-1-amine |
| PubChem CID | 59344524 |
| Molecular Formula | C3H8N6O4 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3,5-dinitro-1,3,5-triazinan-1-amine |
| SMILES | NN1CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C3H8N6O4/c4-5-1-6(8(10)11)3-7(2-5)9(12)13/h1-4H2 |
| InChIKey | OZBJBSQBOSOCNS-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dinitro-1,3,5-triazinan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dinitro-1,3,5-triazinan-1-amine?
The IUPAC name of 3,5-dinitro-1,3,5-triazinan-1-amine (CID 59344524) is 3,5-dinitro-1,3,5-triazinan-1-amine.
What is the SMILES notation for 3,5-dinitro-1,3,5-triazinan-1-amine?
The canonical SMILES for 3,5-dinitro-1,3,5-triazinan-1-amine is NN1CN([N+](=O)[O-])CN([N+](=O)[O-])C1.
What is the InChIKey of 3,5-dinitro-1,3,5-triazinan-1-amine?
The InChIKey is OZBJBSQBOSOCNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N6O4/c4-5-1-6(8(10)11)3-7(2-5)9(12)13/h1-4H2.
What are the key properties of 3,5-dinitro-1,3,5-triazinan-1-amine?
3,5-dinitro-1,3,5-triazinan-1-amine has a molecular weight of 192.13 g/mol, XLogP of -1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dinitro-1,3,5-triazinan-1-amine is sourced from PubChem (CID 59344524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).