About 5-nitro-1,3,5-triazinane-1,3-diamine
5-nitro-1,3,5-triazinane-1,3-diamine (PubChem CID 59344548) has the molecular formula C3H10N6O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 5-nitro-1,3,5-triazinane-1,3-diamine.
Molecular Properties
| Compound Name | 5-nitro-1,3,5-triazinane-1,3-diamine |
| PubChem CID | 59344548 |
| Molecular Formula | C3H10N6O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-nitro-1,3,5-triazinane-1,3-diamine |
| SMILES | NN1CN(N)CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C3H10N6O2/c4-6-1-7(5)3-8(2-6)9(10)11/h1-5H2 |
| InChIKey | ICRIQJHYXFQHPT-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1,3,5-triazinane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1,3,5-triazinane-1,3-diamine?
The IUPAC name of 5-nitro-1,3,5-triazinane-1,3-diamine (CID 59344548) is 5-nitro-1,3,5-triazinane-1,3-diamine.
What is the SMILES notation for 5-nitro-1,3,5-triazinane-1,3-diamine?
The canonical SMILES for 5-nitro-1,3,5-triazinane-1,3-diamine is NN1CN(N)CN([N+](=O)[O-])C1.
What is the InChIKey of 5-nitro-1,3,5-triazinane-1,3-diamine?
The InChIKey is ICRIQJHYXFQHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N6O2/c4-6-1-7(5)3-8(2-6)9(10)11/h1-5H2.
What are the key properties of 5-nitro-1,3,5-triazinane-1,3-diamine?
5-nitro-1,3,5-triazinane-1,3-diamine has a molecular weight of 162.15 g/mol, XLogP of -2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1,3,5-triazinane-1,3-diamine is sourced from PubChem (CID 59344548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).