C39H71N11O6 — CID 59344598
N-[15,23-bis[6-(methylamino)hexanoylamino]-2,10,18-trioxo-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosan-7-yl]heptanamide (PubChem CID 59344598) has the molecular formula C39H71N11O6 and a molecular weight of 790.07 g/mol. Its IUPAC name is N-[15,23-bis[6-(methylamino)hexanoylamino]-2,10,18-trioxo-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosan-7-yl]heptanamide.
| Compound Name | N-[15,23-bis[6-(methylamino)hexanoylamino]-2,10,18-trioxo-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosan-7-yl]heptanamide |
|---|---|
| PubChem CID | 59344598 |
| Molecular Formula | C39H71N11O6 |
| Molecular Weight | 790.07 g/mol |
| Exact Mass | 789.56 |
| IUPAC Name | N-[15,23-bis[6-(methylamino)hexanoylamino]-2,10,18-trioxo-1,3,9,11,17,19-hexazatetracyclo[19.3.0.05,9.013,17]tetracosan-7-yl]heptanamide |
| SMILES | CCCCCCC(=O)NC1CC2CNC(=O)N3CC(NC(=O)CCCCCNC)CC3CNC(=O)N3CC(NC(=O)CCCCCNC)CC3CNC(=O)N2C1 |
| InChI | InChI=1S/C39H71N11O6/c1-4-5-6-9-14-34(51)45-28-19-31-22-42-38(55)49-26-30(47-36(53)16-11-8-13-18-41-3)21-33(49)24-44-39(56)50-27-29(46-35(52)15-10-7-12-17-40-2)20-32(50)23-43-37(54)48(31)25-28/h28-33,40-41H,4-27H2,1-3H3,(H,42,55)(H,43,54)(H,44,56)(H,45,51)(H,46,52)(H,47,53) |
| InChIKey | CMUNEDJEAARKGX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 208.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.07 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|