C19H30N2O5 — CID 59344618
tert-butyl (2S,4R)-2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methylpyrrolidine-1-carboxylate (PubChem CID 59344618) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59344618 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methylpyrrolidine-1-carboxylate |
| SMILES | C=CC1CC1(NC(=O)[C@@H]1C[C@@H](C)CN1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H30N2O5/c1-7-13-10-19(13,16(23)25-8-2)20-15(22)14-9-12(3)11-21(14)17(24)26-18(4,5)6/h7,12-14H,1,8-11H2,2-6H3,(H,20,22)/t12-,13?,14+,19?/m1/s1 |
| InChIKey | RWAHMDXHGWVQSG-GWMLXNDSSA-N |
| XLogP | 2.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|