C18H31NO4 — CID 59344939
tert-butyl (4S)-2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 59344939) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59344939 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-(2-prop-2-enoxypent-4-enyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCOC(CC=C)C[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO4/c1-8-10-15(21-11-9-2)12-14-13-22-18(6,7)19(14)16(20)23-17(3,4)5/h8-9,14-15H,1-2,10-13H2,3-7H3/t14-,15?/m0/s1 |
| InChIKey | YPVUHXDEUFPZMA-MLCCFXAWSA-N |
| XLogP | 3.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|