About ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate
ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate (PubChem CID 59345184) has the molecular formula C14H17NO3S
and a molecular weight of 279.36 g/mol. Its IUPAC name is ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate |
| PubChem CID | 59345184 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccs2)oc1CC(C)C |
| InChI | InChI=1S/C14H17NO3S/c1-4-17-14(16)12-10(8-9(2)3)18-13(15-12)11-6-5-7-19-11/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | WDXPEEXGZWKKBH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate (CID 59345184) is ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate is CCOC(=O)c1nc(-c2cccs2)oc1CC(C)C.
What is the InChIKey of ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate?
The InChIKey is WDXPEEXGZWKKBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-4-17-14(16)12-10(8-9(2)3)18-13(15-12)11-6-5-7-19-11/h5-7,9H,4,8H2,1-3H3.
What are the key properties of ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate?
ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate has a molecular weight of 279.36 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2-methylpropyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 59345184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).