About 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine
2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine (PubChem CID 59346181) has the molecular formula C36H27F6N3
and a molecular weight of 615.62 g/mol. Its IUPAC name is 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine |
| PubChem CID | 59346181 |
| Molecular Formula | C36H27F6N3 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine |
| SMILES | CC(C)(C)c1nc2c(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)ccnc2n1-c1ccc(-c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H27F6N3/c1-34(2,3)33-44-31-28(24-14-16-26(22-10-6-4-7-11-22)29(20-24)35(37,38)39)18-19-43-32(31)45(33)25-15-17-27(23-12-8-5-9-13-23)30(21-25)36(40,41)42/h4-21H,1-3H3 |
| InChIKey | NYYDHJXKYLODAD-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine?
The IUPAC name of 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine (CID 59346181) is 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine?
The canonical SMILES for 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine is CC(C)(C)c1nc2c(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)ccnc2n1-c1ccc(-c2ccccc2)c(C(F)(F)F)c1.
What is the InChIKey of 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine?
The InChIKey is NYYDHJXKYLODAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H27F6N3/c1-34(2,3)33-44-31-28(24-14-16-26(22-10-6-4-7-11-22)29(20-24)35(37,38)39)18-19-43-32(31)45(33)25-15-17-27(23-12-8-5-9-13-23)30(21-25)36(40,41)42/h4-21H,1-3H3.
What are the key properties of 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine?
2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine has a molecular weight of 615.62 g/mol, XLogP of 10.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,7-bis[4-phenyl-3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridine is sourced from PubChem (CID 59346181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).