C13H16N4O6S — CID 59346357
[(2R,3S,4R,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 59346357) has the molecular formula C13H16N4O6S and a molecular weight of 356.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59346357 |
| Molecular Formula | C13H16N4O6S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(=O)sc3c(C)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16N4O6S/c1-4-9-10(16-12(14)15-4)17(13(21)24-9)11-8(20)7(19)6(23-11)3-22-5(2)18/h6-8,11,19-20H,3H2,1-2H3,(H2,14,15,16)/t6-,7-,8-,11-/m1/s1 |
| InChIKey | JBOWOPREVWMJTH-KCGFPETGSA-N |
| XLogP | -1.07 |
| TPSA | 149.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |