About CID 59347030
CID 59347030 (PubChem CID 59347030) has the molecular formula C8H8F+
and a molecular weight of 123.15 g/mol.
Molecular Properties
| Compound Name | CID 59347030 |
| PubChem CID | 59347030 |
| Molecular Formula | C8H8F+ |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.06 |
| IUPAC Name | — |
| SMILES | [CH2+]c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H8F/c1-6-3-4-7(2)8(9)5-6/h3-5H,1H2,2H3/q+1 |
| InChIKey | ZSYYBPVXSDRTHR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59347030 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59347030?
The IUPAC name of CID 59347030 (CID 59347030) is not available.
What is the SMILES notation for CID 59347030?
The canonical SMILES for CID 59347030 is [CH2+]c1ccc(C)c(F)c1.
What is the InChIKey of CID 59347030?
The InChIKey is ZSYYBPVXSDRTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F/c1-6-3-4-7(2)8(9)5-6/h3-5H,1H2,2H3/q+1.
What are the key properties of CID 59347030?
CID 59347030 has a molecular weight of 123.15 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59347030 is sourced from PubChem (CID 59347030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).