About tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate
tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate (PubChem CID 59347068) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate |
| PubChem CID | 59347068 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate |
| SMILES | CC/C=C\[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO2/c1-5-6-12-15(13-14-10-8-7-9-11-14)18-16(19)20-17(2,3)4/h6-12,15H,5,13H2,1-4H3,(H,18,19)/b12-6-/t15-/m1/s1 |
| InChIKey | GQFGVUWZXZIRSN-NYXMJBRJSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate (CID 59347068) is tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate is CC/C=C\[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate?
The InChIKey is GQFGVUWZXZIRSN-NYXMJBRJSA-N. The full InChI is InChI=1S/C17H25NO2/c1-5-6-12-15(13-14-10-8-7-9-11-14)18-16(19)20-17(2,3)4/h6-12,15H,5,13H2,1-4H3,(H,18,19)/b12-6-/t15-/m1/s1.
What are the key properties of tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate?
tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate has a molecular weight of 275.39 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z,2S)-1-phenylhex-3-en-2-yl]carbamate is sourced from PubChem (CID 59347068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).