C14H22F3N3O4 — CID 59347536
tert-butyl 4-[(3,3,3-trifluoropropanoylamino)carbamoyl]piperidine-1-carboxylate (PubChem CID 59347536) has the molecular formula C14H22F3N3O4 and a molecular weight of 353.34 g/mol. Its IUPAC name is tert-butyl 4-[(3,3,3-trifluoropropanoylamino)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3,3,3-trifluoropropanoylamino)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59347536 |
| Molecular Formula | C14H22F3N3O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | tert-butyl 4-[(3,3,3-trifluoropropanoylamino)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H22F3N3O4/c1-13(2,3)24-12(23)20-6-4-9(5-7-20)11(22)19-18-10(21)8-14(15,16)17/h9H,4-8H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | UDKWOBWSDILOJT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|