C27H32NO+ — CID 59347593
3-(4-cyclopenta-2,4-dien-1-ylbutyl)-2,3-dimethyl-1-(2-phenoxyethyl)indol-1-ium (PubChem CID 59347593) has the molecular formula C27H32NO+ and a molecular weight of 386.56 g/mol. Its IUPAC name is 3-(4-cyclopenta-2,4-dien-1-ylbutyl)-2,3-dimethyl-1-(2-phenoxyethyl)indol-1-ium.
| Compound Name | 3-(4-cyclopenta-2,4-dien-1-ylbutyl)-2,3-dimethyl-1-(2-phenoxyethyl)indol-1-ium |
|---|---|
| PubChem CID | 59347593 |
| Molecular Formula | C27H32NO+ |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 3-(4-cyclopenta-2,4-dien-1-ylbutyl)-2,3-dimethyl-1-(2-phenoxyethyl)indol-1-ium |
| SMILES | CC1=[N+](CCOc2ccccc2)c2ccccc2C1(C)CCCCC1C=CC=C1 |
| InChI | InChI=1S/C27H32NO/c1-22-27(2,19-11-10-14-23-12-6-7-13-23)25-17-8-9-18-26(25)28(22)20-21-29-24-15-4-3-5-16-24/h3-9,12-13,15-18,23H,10-11,14,19-21H2,1-2H3/q+1 |
| InChIKey | RKUMAIQQPMQGBM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|