About CID 59347758
CID 59347758 (PubChem CID 59347758) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol.
Molecular Properties
| Compound Name | CID 59347758 |
| PubChem CID | 59347758 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | — |
| SMILES | [CH]CN1CCC(O)CC1 |
| InChI | InChI=1S/C7H13NO/c1-2-8-5-3-7(9)4-6-8/h1,7,9H,2-6H2 |
| InChIKey | BLZURJNSCFSWGD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59347758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59347758?
The IUPAC name of CID 59347758 (CID 59347758) is not available.
What is the SMILES notation for CID 59347758?
The canonical SMILES for CID 59347758 is [CH]CN1CCC(O)CC1.
What is the InChIKey of CID 59347758?
The InChIKey is BLZURJNSCFSWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-2-8-5-3-7(9)4-6-8/h1,7,9H,2-6H2.
What are the key properties of CID 59347758?
CID 59347758 has a molecular weight of 127.19 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59347758 is sourced from PubChem (CID 59347758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).