C25H31F3IN3O4Si — CID 59348032
N-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 59348032) has the molecular formula C25H31F3IN3O4Si and a molecular weight of 649.52 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 59348032 |
| Molecular Formula | C25H31F3IN3O4Si |
| Molecular Weight | 649.52 g/mol |
| Exact Mass | 649.11 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1cc(C(=O)NOCCO[Si](C)(C)C(C)(C)C)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C25H31F3IN3O4Si/c1-7-20(33)30-14-15-12-17(24(34)32-35-10-11-36-37(5,6)25(2,3)4)23(22(28)21(15)27)31-19-9-8-16(29)13-18(19)26/h7-9,12-13,31H,1,10-11,14H2,2-6H3,(H,30,33)(H,32,34) |
| InChIKey | QVSKXHULNNKNFA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|