About (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane
(3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane (PubChem CID 59348058) has the molecular formula C10H12O3
and a molecular weight of 183.22 g/mol. Its IUPAC name is (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane.
Molecular Properties
| Compound Name | (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane |
| PubChem CID | 59348058 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane |
| SMILES | [2H]C1([2H])O[C@]1([2H])c1cccc(OCOC)c1 |
| InChI | InChI=1S/C10H12O3/c1-11-7-13-9-4-2-3-8(5-9)10-6-12-10/h2-5,10H,6-7H2,1H3/t10-/m0/s1/i6D2,10D |
| InChIKey | DFAGXITXCGGFFH-YOQPZMKCSA-N |
| XLogP | 1.74 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane?
The IUPAC name of (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane (CID 59348058) is (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane.
What is the SMILES notation for (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane?
The canonical SMILES for (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane is [2H]C1([2H])O[C@]1([2H])c1cccc(OCOC)c1.
What is the InChIKey of (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane?
The InChIKey is DFAGXITXCGGFFH-YOQPZMKCSA-N. The full InChI is InChI=1S/C10H12O3/c1-11-7-13-9-4-2-3-8(5-9)10-6-12-10/h2-5,10H,6-7H2,1H3/t10-/m0/s1/i6D2,10D.
What are the key properties of (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane?
(3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane has a molecular weight of 183.22 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,2,3-trideuterio-3-[3-(methoxymethoxy)phenyl]oxirane is sourced from PubChem (CID 59348058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).