C32H32N2O4 — CID 59348080
dimethyl 9,19-ditert-butyl-3,13-diazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene-4,14-dicarboxylate (PubChem CID 59348080) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is dimethyl 9,19-ditert-butyl-3,13-diazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene-4,14-dicarboxylate.
| Compound Name | dimethyl 9,19-ditert-butyl-3,13-diazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene-4,14-dicarboxylate |
|---|---|
| PubChem CID | 59348080 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | dimethyl 9,19-ditert-butyl-3,13-diazahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene-4,14-dicarboxylate |
| SMILES | COC(=O)c1cc2c3cc(C(C)(C)C)cc4c5[nH]c(C(=O)OC)cc5c5cc(C(C)(C)C)cc(c2[nH]1)c5c34 |
| InChI | InChI=1S/C32H32N2O4/c1-31(2,3)15-9-17-19-13-23(29(35)37-7)34-28(19)22-12-16(32(4,5)6)10-18-20-14-24(30(36)38-8)33-27(20)21(11-15)25(17)26(18)22/h9-14,33-34H,1-8H3 |
| InChIKey | DJQWMXDLAOCODY-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|