C18H8N4O2 — CID 59348106
3,6,13,16-tetrazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2,4,8,10,12,14,18(22),19-nonaene-7,17-dione (PubChem CID 59348106) has the molecular formula C18H8N4O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3,6,13,16-tetrazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2,4,8,10,12,14,18(22),19-nonaene-7,17-dione.
| Compound Name | 3,6,13,16-tetrazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2,4,8,10,12,14,18(22),19-nonaene-7,17-dione |
|---|---|
| PubChem CID | 59348106 |
| Molecular Formula | C18H8N4O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3,6,13,16-tetrazahexacyclo[9.9.2.02,6.08,21.012,16.018,22]docosa-1(21),2,4,8,10,12,14,18(22),19-nonaene-7,17-dione |
| SMILES | O=c1c2ccc3c4c(ccc(c24)c2nccn12)c(=O)n1ccnc31 |
| InChI | InChI=1S/C18H8N4O2/c23-17-11-3-1-9-13-12(18(24)21-7-5-19-15(9)21)4-2-10(14(11)13)16-20-6-8-22(16)17/h1-8H |
| InChIKey | LOFBMSVUFSKZLI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|