C36H31IrN6 — CID 59348244
iridium(3+);bis(1-phenylpyrazole);2-phenyl-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 59348244) has the molecular formula C36H31IrN6 and a molecular weight of 739.90 g/mol. Its IUPAC name is iridium(3+);bis(1-phenylpyrazole);2-phenyl-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | iridium(3+);bis(1-phenylpyrazole);2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 59348244 |
| Molecular Formula | C36H31IrN6 |
| Molecular Weight | 739.90 g/mol |
| Exact Mass | 740.22 |
| IUPAC Name | iridium(3+);bis(1-phenylpyrazole);2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.[Ir+3].[c-]1ccccc1-n1cccn1.[c-]1ccccc1-n1cccn1 |
| InChI | InChI=1S/C18H17N2.2C9H7N2.Ir/c1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;2*1-2-5-9(6-3-1)11-8-4-7-10-11;/h4-7,9-12H,1-3H3;2*1-5,7-8H;/q3*-1;+3 |
| InChIKey | VGVWVRUXGCRQMW-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.90 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|