About 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum
4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum (PubChem CID 59348261) has the molecular formula C19H17N2Pt-
and a molecular weight of 468.44 g/mol. Its IUPAC name is 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum.
Molecular Properties
| Compound Name | 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum |
| PubChem CID | 59348261 |
| Molecular Formula | C19H17N2Pt- |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum |
| SMILES | Cn1cnc(-c2[c-]cc3c(c2)C(C)(C)c2ccccc2-3)c1.[Pt] |
| InChI | InChI=1S/C19H17N2.Pt/c1-19(2)16-7-5-4-6-14(16)15-9-8-13(10-17(15)19)18-11-21(3)12-20-18;/h4-7,9-12H,1-3H3;/q-1; |
| InChIKey | KHPDOLOLZMUXRB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum?
The IUPAC name of 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum (CID 59348261) is 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum.
What is the SMILES notation for 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum?
The canonical SMILES for 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum is Cn1cnc(-c2[c-]cc3c(c2)C(C)(C)c2ccccc2-3)c1.[Pt].
What is the InChIKey of 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum?
The InChIKey is KHPDOLOLZMUXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N2.Pt/c1-19(2)16-7-5-4-6-14(16)15-9-8-13(10-17(15)19)18-11-21(3)12-20-18;/h4-7,9-12H,1-3H3;/q-1;.
What are the key properties of 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum?
4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum has a molecular weight of 468.44 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-1-methylimidazole;platinum is sourced from PubChem (CID 59348261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).