C30H36S — CID 59348400
1,2,3,4,6,8,9-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)dibenzothiophene (PubChem CID 59348400) has the molecular formula C30H36S and a molecular weight of 428.69 g/mol. Its IUPAC name is 1,2,3,4,6,8,9-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)dibenzothiophene.
| Compound Name | 1,2,3,4,6,8,9-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)dibenzothiophene |
|---|---|
| PubChem CID | 59348400 |
| Molecular Formula | C30H36S |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1,2,3,4,6,8,9-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)dibenzothiophene |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(C)c3c(sc4c(C)c(C)c(C)c(C)c43)c2C)c(C)c1C |
| InChI | InChI=1S/C30H36S/c1-13-14(2)18(6)25(19(7)15(13)3)26-21(9)22(10)28-27-20(8)16(4)17(5)23(11)29(27)31-30(28)24(26)12/h1-12H3 |
| InChIKey | VOMTVRHBAJUIOV-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |