About 2-bromo-9a,10-dihydro-4aH-anthracen-9-one
2-bromo-9a,10-dihydro-4aH-anthracen-9-one (PubChem CID 59348649) has the molecular formula C14H11BrO
and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-bromo-9a,10-dihydro-4aH-anthracen-9-one.
Molecular Properties
| Compound Name | 2-bromo-9a,10-dihydro-4aH-anthracen-9-one |
| PubChem CID | 59348649 |
| Molecular Formula | C14H11BrO |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-bromo-9a,10-dihydro-4aH-anthracen-9-one |
| SMILES | O=C1c2ccccc2CC2C=CC(Br)=CC12 |
| InChI | InChI=1S/C14H11BrO/c15-11-6-5-10-7-9-3-1-2-4-12(9)14(16)13(10)8-11/h1-6,8,10,13H,7H2 |
| InChIKey | HEAITYMELGWRSS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-9a,10-dihydro-4aH-anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9a,10-dihydro-4aH-anthracen-9-one?
The IUPAC name of 2-bromo-9a,10-dihydro-4aH-anthracen-9-one (CID 59348649) is 2-bromo-9a,10-dihydro-4aH-anthracen-9-one.
What is the SMILES notation for 2-bromo-9a,10-dihydro-4aH-anthracen-9-one?
The canonical SMILES for 2-bromo-9a,10-dihydro-4aH-anthracen-9-one is O=C1c2ccccc2CC2C=CC(Br)=CC12.
What is the InChIKey of 2-bromo-9a,10-dihydro-4aH-anthracen-9-one?
The InChIKey is HEAITYMELGWRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrO/c15-11-6-5-10-7-9-3-1-2-4-12(9)14(16)13(10)8-11/h1-6,8,10,13H,7H2.
What are the key properties of 2-bromo-9a,10-dihydro-4aH-anthracen-9-one?
2-bromo-9a,10-dihydro-4aH-anthracen-9-one has a molecular weight of 275.14 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9a,10-dihydro-4aH-anthracen-9-one is sourced from PubChem (CID 59348649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).