C29H28N8O4S — CID 59349423
4-N-[4-[4-(benzenesulfonyl)piperazin-1-yl]-2-methylphenyl]-5-N-(1H-benzimidazol-2-yl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 59349423) has the molecular formula C29H28N8O4S and a molecular weight of 584.66 g/mol. Its IUPAC name is 4-N-[4-[4-(benzenesulfonyl)piperazin-1-yl]-2-methylphenyl]-5-N-(1H-benzimidazol-2-yl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N-[4-[4-(benzenesulfonyl)piperazin-1-yl]-2-methylphenyl]-5-N-(1H-benzimidazol-2-yl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 59349423 |
| Molecular Formula | C29H28N8O4S |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 4-N-[4-[4-(benzenesulfonyl)piperazin-1-yl]-2-methylphenyl]-5-N-(1H-benzimidazol-2-yl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccccc3)CC2)ccc1NC(=O)c1nc[nH]c1C(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C29H28N8O4S/c1-19-17-20(36-13-15-37(16-14-36)42(40,41)21-7-3-2-4-8-21)11-12-22(19)32-27(38)25-26(31-18-30-25)28(39)35-29-33-23-9-5-6-10-24(23)34-29/h2-12,17-18H,13-16H2,1H3,(H,30,31)(H,32,38)(H2,33,34,35,39) |
| InChIKey | GVUACDJWYJEJBC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|