C12H18F2NO4S- — CID 59349843
2,2-difluoro-2-oxidoperoxysulfanyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 59349843) has the molecular formula C12H18F2NO4S- and a molecular weight of 310.34 g/mol. Its IUPAC name is 2,2-difluoro-2-oxidoperoxysulfanyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | 2,2-difluoro-2-oxidoperoxysulfanyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 59349843 |
| Molecular Formula | C12H18F2NO4S- |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2,2-difluoro-2-oxidoperoxysulfanyl-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)C(F)(F)SOO[O-])C2 |
| InChI | InChI=1S/C12H19F2NO4S/c1-10(2)7-4-5-11(10,3)8(6-7)15-9(16)12(13,14)20-19-18-17/h7-8,17H,4-6H2,1-3H3,(H,15,16)/p-1 |
| InChIKey | TVVQRQIEMKHYHQ-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|