About 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate
2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 59349861) has the molecular formula C6H10F2NO4S-
and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate.
Molecular Properties
| Compound Name | 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate |
| PubChem CID | 59349861 |
| Molecular Formula | C6H10F2NO4S- |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CCN(CC)C(=O)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C6H11F2NO4S/c1-3-9(4-2)5(10)6(7,8)14(11,12)13/h3-4H2,1-2H3,(H,11,12,13)/p-1 |
| InChIKey | BKNNHSWEMHPXCH-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate?
The IUPAC name of 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate (CID 59349861) is 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate.
What is the SMILES notation for 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate?
The canonical SMILES for 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate is CCN(CC)C(=O)C(F)(F)S(=O)(=O)[O-].
What is the InChIKey of 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate?
The InChIKey is BKNNHSWEMHPXCH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11F2NO4S/c1-3-9(4-2)5(10)6(7,8)14(11,12)13/h3-4H2,1-2H3,(H,11,12,13)/p-1.
What are the key properties of 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate?
2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate has a molecular weight of 230.21 g/mol, XLogP of -0.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-1,1-difluoro-2-oxoethanesulfonate is sourced from PubChem (CID 59349861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).