About N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide
N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide (PubChem CID 59349889) has the molecular formula C19H22F2NO4S-
and a molecular weight of 398.45 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide.
Molecular Properties
| Compound Name | N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide |
| PubChem CID | 59349889 |
| Molecular Formula | C19H22F2NO4S- |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide |
| SMILES | O=C(N(CC12CC3CC(CC(C3)C1)C2)c1ccccc1)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C19H23F2NO4S/c20-19(21,27-26-25-24)17(23)22(16-4-2-1-3-5-16)12-18-9-13-6-14(10-18)8-15(7-13)11-18/h1-5,13-15,24H,6-12H2/p-1 |
| InChIKey | BKGZDQIPODRNDE-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide?
The IUPAC name of N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide (CID 59349889) is N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide.
What is the SMILES notation for N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide?
The canonical SMILES for N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide is O=C(N(CC12CC3CC(CC(C3)C1)C2)c1ccccc1)C(F)(F)SOO[O-].
What is the InChIKey of N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide?
The InChIKey is BKGZDQIPODRNDE-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H23F2NO4S/c20-19(21,27-26-25-24)17(23)22(16-4-2-1-3-5-16)12-18-9-13-6-14(10-18)8-15(7-13)11-18/h1-5,13-15,24H,6-12H2/p-1.
What are the key properties of N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide?
N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide has a molecular weight of 398.45 g/mol, XLogP of 3.70, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantylmethyl)-2,2-difluoro-2-oxidoperoxysulfanyl-N-phenylacetamide is sourced from PubChem (CID 59349889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).