C24H28N2 — CID 59350038
(1R)-5-[(1R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene (PubChem CID 59350038) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (1R)-5-[(1R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R)-5-[(1R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 59350038 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | (1R)-5-[(1R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)C2Cc3cc(-c4cc5c(cn4)[C@@H]4CC(C5)C4(C)C)ncc3[C@@H]1C2 |
| InChI | InChI=1S/C24H28N2/c1-23(2)15-5-13-7-21(25-11-17(13)19(23)9-15)22-8-14-6-16-10-20(24(16,3)4)18(14)12-26-22/h7-8,11-12,15-16,19-20H,5-6,9-10H2,1-4H3/t15?,16?,19-,20-/m0/s1 |
| InChIKey | QEANTWDJTHIDIO-PNGKTBNWSA-N |
| XLogP | 5.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |