About ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate
ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate (PubChem CID 59350097) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate.
Molecular Properties
| Compound Name | ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate |
| PubChem CID | 59350097 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate |
| SMILES | CCOC(=O)C(C)(CC=C(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O3/c1-8-18-13(17)15(7,10-9-11(2)3)12(16)14(4,5)6/h9H,8,10H2,1-7H3 |
| InChIKey | VJJWGBOUYUOUMO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate?
The IUPAC name of ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate (CID 59350097) is ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate.
What is the SMILES notation for ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate?
The canonical SMILES for ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate is CCOC(=O)C(C)(CC=C(C)C)C(=O)C(C)(C)C.
What is the InChIKey of ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate?
The InChIKey is VJJWGBOUYUOUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-8-18-13(17)15(7,10-9-11(2)3)12(16)14(4,5)6/h9H,8,10H2,1-7H3.
What are the key properties of ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate?
ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate has a molecular weight of 254.37 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-dimethylpropanoyl)-2,5-dimethylhex-4-enoate is sourced from PubChem (CID 59350097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).