C22H25NO12 — CID 59350302
[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate (PubChem CID 59350302) has the molecular formula C22H25NO12 and a molecular weight of 495.44 g/mol. Its IUPAC name is [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 59350302 |
| Molecular Formula | C22H25NO12 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate |
| SMILES | CC(C)(C)OC(=O)NCC(COC(=O)c1cc(O)c(O)c(O)c1)OC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H25NO12/c1-22(2,3)35-21(32)23-8-12(34-20(31)11-6-15(26)18(29)16(27)7-11)9-33-19(30)10-4-13(24)17(28)14(25)5-10/h4-7,12,24-29H,8-9H2,1-3H3,(H,23,32) |
| InChIKey | AOGMJFCXXKZZFA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 212.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|