C18H16F3NO7 — CID 59350325
3-[[3-(trifluoromethyl)phenoxy]carbonylamino]propyl 3,4,5-trihydroxybenzoate (PubChem CID 59350325) has the molecular formula C18H16F3NO7 and a molecular weight of 415.32 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenoxy]carbonylamino]propyl 3,4,5-trihydroxybenzoate.
| Compound Name | 3-[[3-(trifluoromethyl)phenoxy]carbonylamino]propyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 59350325 |
| Molecular Formula | C18H16F3NO7 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenoxy]carbonylamino]propyl 3,4,5-trihydroxybenzoate |
| SMILES | O=C(NCCCOC(=O)c1cc(O)c(O)c(O)c1)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3NO7/c19-18(20,21)11-3-1-4-12(9-11)29-17(27)22-5-2-6-28-16(26)10-7-13(23)15(25)14(24)8-10/h1,3-4,7-9,23-25H,2,5-6H2,(H,22,27) |
| InChIKey | MICZPVZWYGKHGE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|