C20H20O10 — CID 59350343
[(1R,3R)-3-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate (PubChem CID 59350343) has the molecular formula C20H20O10 and a molecular weight of 420.37 g/mol. Its IUPAC name is [(1R,3R)-3-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(1R,3R)-3-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 59350343 |
| Molecular Formula | C20H20O10 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [(1R,3R)-3-(3,4,5-trihydroxybenzoyl)oxycyclohexyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(O[C@@H]1CCC[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)C1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C20H20O10/c21-13-4-9(5-14(22)17(13)25)19(27)29-11-2-1-3-12(8-11)30-20(28)10-6-15(23)18(26)16(24)7-10/h4-7,11-12,21-26H,1-3,8H2/t11-,12-/m1/s1 |
| InChIKey | VQONGERHAUPNSO-VXGBXAGGSA-N |
| XLogP | 2.25 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|