C24H20FNO12 — CID 59350371
[3-[(4-fluorophenoxy)carbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate (PubChem CID 59350371) has the molecular formula C24H20FNO12 and a molecular weight of 533.42 g/mol. Its IUPAC name is [3-[(4-fluorophenoxy)carbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3-[(4-fluorophenoxy)carbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 59350371 |
| Molecular Formula | C24H20FNO12 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | [3-[(4-fluorophenoxy)carbonylamino]-2-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(NCC(COC(=O)c1cc(O)c(O)c(O)c1)OC(=O)c1cc(O)c(O)c(O)c1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FNO12/c25-13-1-3-14(4-2-13)38-24(35)26-9-15(37-23(34)12-7-18(29)21(32)19(30)8-12)10-36-22(33)11-5-16(27)20(31)17(28)6-11/h1-8,15,27-32H,9-10H2,(H,26,35) |
| InChIKey | CDAMPTFLPBCPSL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 212.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|