C25H38O5 — CID 59350598
[(3R,7S,8S,8aR)-2,2,3,4,5,6,7-heptadeuterio-8-[2-[(4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-8,8a-dihydro-1H-naphthalen-1-yl] 2,2-bis(trideuteriomethyl)butanoate (PubChem CID 59350598) has the molecular formula C25H38O5 and a molecular weight of 431.65 g/mol. Its IUPAC name is [(3R,7S,8S,8aR)-2,2,3,4,5,6,7-heptadeuterio-8-[2-[(4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-8,8a-dihydro-1H-naphthalen-1-yl] 2,2-bis(trideuteriomethyl)butanoate.
| Compound Name | [(3R,7S,8S,8aR)-2,2,3,4,5,6,7-heptadeuterio-8-[2-[(4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-8,8a-dihydro-1H-naphthalen-1-yl] 2,2-bis(trideuteriomethyl)butanoate |
|---|---|
| PubChem CID | 59350598 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.35 |
| IUPAC Name | [(3R,7S,8S,8aR)-2,2,3,4,5,6,7-heptadeuterio-8-[2-[(4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-8,8a-dihydro-1H-naphthalen-1-yl] 2,2-bis(trideuteriomethyl)butanoate |
| SMILES | [2H]C1=C([2H])[C@]([2H])(C)[C@H](CCC2C[C@@H](O)CC(=O)O2)[C@@H]2C1=C([2H])[C@]([2H])(C)C([2H])([2H])C2OC(=O)C(CC)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19?,20-,21?,23-/m0/s1/i4D3,5D3,7D,8D,11D,12D2,15D,16D |
| InChIKey | RYMZZMVNJRMUDD-TZZVUONVSA-N |
| XLogP | 4.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |