C30H50O6Si — CID 59350732
[(7R,8R,8aR)-8-[2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-6-oxo-3-(trideuteriomethyl)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 59350732) has the molecular formula C30H50O6Si and a molecular weight of 537.83 g/mol. Its IUPAC name is [(7R,8R,8aR)-8-[2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-6-oxo-3-(trideuteriomethyl)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(7R,8R,8aR)-8-[2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-6-oxo-3-(trideuteriomethyl)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 59350732 |
| Molecular Formula | C30H50O6Si |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | [(7R,8R,8aR)-8-[2-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-7-methyl-6-oxo-3-(trideuteriomethyl)-2,3,4,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | [2H]C([2H])([2H])C1CC2=CC(=O)[C@H](C)[C@H](CCC3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]2C(OC(=O)[C@@H](C)CC)C1 |
| InChI | InChI=1S/C30H50O6Si/c1-10-19(3)29(33)35-26-14-18(2)13-21-15-25(31)20(4)24(28(21)26)12-11-22-16-23(17-27(32)34-22)36-37(8,9)30(5,6)7/h15,18-20,22-24,26,28H,10-14,16-17H2,1-9H3/t18?,19-,20+,22?,23+,24-,26?,28-/m0/s1/i2D3 |
| InChIKey | NIKPZIVSUBMLHE-GLWYJAOJSA-N |
| XLogP | 6.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|