About 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene
1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene (PubChem CID 59350966) has the molecular formula C12H16F6
and a molecular weight of 274.25 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene |
| PubChem CID | 59350966 |
| Molecular Formula | C12H16F6 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene |
| SMILES | CC(C)(C)CC1=CCCC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6/c1-9(2,3)7-8-5-4-6-10(8,11(13,14)15)12(16,17)18/h5H,4,6-7H2,1-3H3 |
| InChIKey | HTWMIXVFNOWAKO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene?
The IUPAC name of 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene (CID 59350966) is 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene?
The canonical SMILES for 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene is CC(C)(C)CC1=CCCC1(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene?
The InChIKey is HTWMIXVFNOWAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F6/c1-9(2,3)7-8-5-4-6-10(8,11(13,14)15)12(16,17)18/h5H,4,6-7H2,1-3H3.
What are the key properties of 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene?
1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene has a molecular weight of 274.25 g/mol, XLogP of 5.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-5,5-bis(trifluoromethyl)cyclopentene is sourced from PubChem (CID 59350966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).