6-methyloct-5-enoic acid

C9H16O2 — CID 593510

IUPAC6-methyloct-5-enoic acid
SMILESCCC(C)=CCCCC(=O)O
InChIInChI=1S/C9H16O2/c1-3-8(2)6-4-5-7-9(10)11/h6H,3-5,7H2,1-2H3,(H,10,11)
InChIKeyGZECLTXOPLOEJY-UHFFFAOYSA-N
MW156.22 g/mol
LogP2.60
Rot. Bonds5

About 6-methyloct-5-enoic acid

6-methyloct-5-enoic acid (PubChem CID 593510) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 6-methyloct-5-enoic acid.

Molecular Properties

Compound Name6-methyloct-5-enoic acid
PubChem CID593510
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Name6-methyloct-5-enoic acid
SMILESCCC(C)=CCCCC(=O)O
InChIInChI=1S/C9H16O2/c1-3-8(2)6-4-5-7-9(10)11/h6H,3-5,7H2,1-2H3,(H,10,11)
InChIKeyGZECLTXOPLOEJY-UHFFFAOYSA-N
XLogP2.60
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 52.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-methyloct-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methyloct-5-enoic acid?
The IUPAC name of 6-methyloct-5-enoic acid (CID 593510) is 6-methyloct-5-enoic acid.
What is the SMILES notation for 6-methyloct-5-enoic acid?
The canonical SMILES for 6-methyloct-5-enoic acid is CCC(C)=CCCCC(=O)O.
What is the InChIKey of 6-methyloct-5-enoic acid?
The InChIKey is GZECLTXOPLOEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-8(2)6-4-5-7-9(10)11/h6H,3-5,7H2,1-2H3,(H,10,11).
What are the key properties of 6-methyloct-5-enoic acid?
6-methyloct-5-enoic acid has a molecular weight of 156.22 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyloct-5-enoic acid is sourced from PubChem (CID 593510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).